C14H17F3O — CID 10729894
(Z,1S,2S)-5-methyl-1-phenyl-2-(trifluoromethyl)hex-3-en-1-ol (PubChem CID 10729894) has the molecular formula C14H17F3O and a molecular weight of 258.28 g/mol. Its IUPAC name is (Z,1S,2S)-5-methyl-1-phenyl-2-(trifluoromethyl)hex-3-en-1-ol.
| Compound Name | (Z,1S,2S)-5-methyl-1-phenyl-2-(trifluoromethyl)hex-3-en-1-ol |
|---|---|
| PubChem CID | 10729894 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (Z,1S,2S)-5-methyl-1-phenyl-2-(trifluoromethyl)hex-3-en-1-ol |
| SMILES | CC(C)/C=C\[C@@H]([C@H](O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O/c1-10(2)8-9-12(14(15,16)17)13(18)11-6-4-3-5-7-11/h3-10,12-13,18H,1-2H3/b9-8-/t12-,13+/m0/s1 |
| InChIKey | RIYHAOBVXVFOAU-GFUJYOBASA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|