C11H14O2 — CID 72819461
1-phenylpent-3-ene-1,2-diol (PubChem CID 72819461) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-phenylpent-3-ene-1,2-diol.
| Compound Name | 1-phenylpent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 72819461 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-phenylpent-3-ene-1,2-diol |
| SMILES | CC=CC(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-2-6-10(12)11(13)9-7-4-3-5-8-9/h2-8,10-13H,1H3 |
| InChIKey | PPWSYJNJVOLOQY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|