C13H16 — CID 102268055
[(2E,5E)-hepta-2,5-dien-4-yl]benzene (PubChem CID 102268055) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is [(2E,5E)-hepta-2,5-dien-4-yl]benzene.
| Compound Name | [(2E,5E)-hepta-2,5-dien-4-yl]benzene |
|---|---|
| PubChem CID | 102268055 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | [(2E,5E)-hepta-2,5-dien-4-yl]benzene |
| SMILES | C/C=C/C(/C=C/C)c1ccccc1 |
| InChI | InChI=1S/C13H16/c1-3-8-12(9-4-2)13-10-6-5-7-11-13/h3-12H,1-2H3/b8-3+,9-4+ |
| InChIKey | JXUSELBXPWAGNU-BQYBEJQRSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|