C18H18O — CID 101207780
(E,2S,3R)-2,3-diphenylhex-4-enal (PubChem CID 101207780) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (E,2S,3R)-2,3-diphenylhex-4-enal.
| Compound Name | (E,2S,3R)-2,3-diphenylhex-4-enal |
|---|---|
| PubChem CID | 101207780 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (E,2S,3R)-2,3-diphenylhex-4-enal |
| SMILES | C/C=C/[C@@H](c1ccccc1)[C@H](C=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-2-9-17(15-10-5-3-6-11-15)18(14-19)16-12-7-4-8-13-16/h2-14,17-18H,1H3/b9-2+/t17-,18+/m0/s1 |
| InChIKey | PNSFLPYYKXUTKT-OEQDEIAVSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|