About (E,2S,3R)-2,3-diphenylhex-4-enal
(E,2S,3R)-2,3-diphenylhex-4-enal (PubChem CID 101207780) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is (E,2S,3R)-2,3-diphenylhex-4-enal.
Molecular Properties
| Compound Name | (E,2S,3R)-2,3-diphenylhex-4-enal |
| PubChem CID | 101207780 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (E,2S,3R)-2,3-diphenylhex-4-enal |
| SMILES | C/C=C/[C@@H](c1ccccc1)[C@H](C=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-2-9-17(15-10-5-3-6-11-15)18(14-19)16-12-7-4-8-13-16/h2-14,17-18H,1H3/b9-2+/t17-,18+/m0/s1 |
| InChIKey | PNSFLPYYKXUTKT-OEQDEIAVSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,2S,3R)-2,3-diphenylhex-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S,3R)-2,3-diphenylhex-4-enal?
The IUPAC name of (E,2S,3R)-2,3-diphenylhex-4-enal (CID 101207780) is (E,2S,3R)-2,3-diphenylhex-4-enal.
What is the SMILES notation for (E,2S,3R)-2,3-diphenylhex-4-enal?
The canonical SMILES for (E,2S,3R)-2,3-diphenylhex-4-enal is C/C=C/[C@@H](c1ccccc1)[C@H](C=O)c1ccccc1.
What is the InChIKey of (E,2S,3R)-2,3-diphenylhex-4-enal?
The InChIKey is PNSFLPYYKXUTKT-OEQDEIAVSA-N. The full InChI is InChI=1S/C18H18O/c1-2-9-17(15-10-5-3-6-11-15)18(14-19)16-12-7-4-8-13-16/h2-14,17-18H,1H3/b9-2+/t17-,18+/m0/s1.
What are the key properties of (E,2S,3R)-2,3-diphenylhex-4-enal?
(E,2S,3R)-2,3-diphenylhex-4-enal has a molecular weight of 250.34 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S,3R)-2,3-diphenylhex-4-enal is sourced from PubChem (CID 101207780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).