C11H14O — CID 129385395
[(E,1S)-1-methoxybut-2-enyl]benzene (PubChem CID 129385395) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is [(E,1S)-1-methoxybut-2-enyl]benzene.
| Compound Name | [(E,1S)-1-methoxybut-2-enyl]benzene |
|---|---|
| PubChem CID | 129385395 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | [(E,1S)-1-methoxybut-2-enyl]benzene |
| SMILES | C/C=C/[C@H](OC)c1ccccc1 |
| InChI | InChI=1S/C11H14O/c1-3-7-11(12-2)10-8-5-4-6-9-10/h3-9,11H,1-2H3/b7-3+/t11-/m0/s1 |
| InChIKey | SGUADOZKVVHBSI-KTROKBFUSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|