C10H22F3NOSi — CID 112548377
1,1,1-trifluoro-5-methyl-2-trimethylsilyloxyhexan-3-amine (PubChem CID 112548377) has the molecular formula C10H22F3NOSi and a molecular weight of 257.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-methyl-2-trimethylsilyloxyhexan-3-amine.
| Compound Name | 1,1,1-trifluoro-5-methyl-2-trimethylsilyloxyhexan-3-amine |
|---|---|
| PubChem CID | 112548377 |
| Molecular Formula | C10H22F3NOSi |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1,1,1-trifluoro-5-methyl-2-trimethylsilyloxyhexan-3-amine |
| SMILES | CC(C)CC(N)C(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H22F3NOSi/c1-7(2)6-8(14)9(10(11,12)13)15-16(3,4)5/h7-9H,6,14H2,1-5H3 |
| InChIKey | WAAYMAUFIAZZHT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|