C11H28O2Si2 — CID 11139503
trimethyl-[(2R,4R)-4-trimethylsilyloxypentan-2-yl]oxysilane (PubChem CID 11139503) has the molecular formula C11H28O2Si2 and a molecular weight of 248.51 g/mol. Its IUPAC name is trimethyl-[(2R,4R)-4-trimethylsilyloxypentan-2-yl]oxysilane.
| Compound Name | trimethyl-[(2R,4R)-4-trimethylsilyloxypentan-2-yl]oxysilane |
|---|---|
| PubChem CID | 11139503 |
| Molecular Formula | C11H28O2Si2 |
| Molecular Weight | 248.51 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | trimethyl-[(2R,4R)-4-trimethylsilyloxypentan-2-yl]oxysilane |
| SMILES | C[C@H](C[C@@H](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H28O2Si2/c1-10(12-14(3,4)5)9-11(2)13-15(6,7)8/h10-11H,9H2,1-8H3/t10-,11-/m1/s1 |
| InChIKey | XVSOSPWDLBCHJR-GHMZBOCLSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|