C13H28O2Si — CID 15503121
[(4R,6S)-6-methoxy-3,3-dimethylhept-1-en-4-yl]oxy-trimethylsilane (PubChem CID 15503121) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is [(4R,6S)-6-methoxy-3,3-dimethylhept-1-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(4R,6S)-6-methoxy-3,3-dimethylhept-1-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15503121 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | [(4R,6S)-6-methoxy-3,3-dimethylhept-1-en-4-yl]oxy-trimethylsilane |
| SMILES | C=CC(C)(C)[C@@H](C[C@H](C)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-9-13(3,4)12(10-11(2)14-5)15-16(6,7)8/h9,11-12H,1,10H2,2-8H3/t11-,12+/m0/s1 |
| InChIKey | CBPQLBPLAQHVCV-NWDGAFQWSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|