C28H53BO6Si — CID 10875059
tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate (PubChem CID 10875059) has the molecular formula C28H53BO6Si and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate.
| Compound Name | tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate |
|---|---|
| PubChem CID | 10875059 |
| Molecular Formula | C28H53BO6Si |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dec-9-enoate |
| SMILES | C=CC(C)(C)[C@H](C[C@@H](CC(=O)CC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H53BO6Si/c1-16-26(8,9)22(33-36(14,15)25(5,6)7)18-20(29-34-27(10,11)28(12,13)35-29)17-21(30)19-23(31)32-24(2,3)4/h16,20,22H,1,17-19H2,2-15H3/t20-,22+/m1/s1 |
| InChIKey | VNPULNVORLNIQU-IRLDBZIGSA-N |
| XLogP | 7.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|