C14H34O4Si3 — CID 523348
trimethylsilyl (2S,4S)-2,4-bis(trimethylsilyloxy)pentanoate (PubChem CID 523348) has the molecular formula C14H34O4Si3 and a molecular weight of 350.68 g/mol. Its IUPAC name is trimethylsilyl (2S,4S)-2,4-bis(trimethylsilyloxy)pentanoate.
| Compound Name | trimethylsilyl (2S,4S)-2,4-bis(trimethylsilyloxy)pentanoate |
|---|---|
| PubChem CID | 523348 |
| Molecular Formula | C14H34O4Si3 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | trimethylsilyl (2S,4S)-2,4-bis(trimethylsilyloxy)pentanoate |
| SMILES | C[C@@H](C[C@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O4Si3/c1-12(16-19(2,3)4)11-13(17-20(5,6)7)14(15)18-21(8,9)10/h12-13H,11H2,1-10H3/t12-,13-/m0/s1 |
| InChIKey | KDUBUBHHCGXSBY-STQMWFEESA-N |
| XLogP | 4.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|