C13H30O3Si2 — CID 553014
trimethylsilyl 2,4-dimethyl-3-trimethylsilyloxypentanoate (PubChem CID 553014) has the molecular formula C13H30O3Si2 and a molecular weight of 290.55 g/mol. Its IUPAC name is trimethylsilyl 2,4-dimethyl-3-trimethylsilyloxypentanoate.
| Compound Name | trimethylsilyl 2,4-dimethyl-3-trimethylsilyloxypentanoate |
|---|---|
| PubChem CID | 553014 |
| Molecular Formula | C13H30O3Si2 |
| Molecular Weight | 290.55 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | trimethylsilyl 2,4-dimethyl-3-trimethylsilyloxypentanoate |
| SMILES | CC(C)C(O[Si](C)(C)C)C(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H30O3Si2/c1-10(2)12(15-17(4,5)6)11(3)13(14)16-18(7,8)9/h10-12H,1-9H3 |
| InChIKey | YSLPGKLCGACVGW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|