C22H53NO7Si5 — CID 91753465
trimethylsilyl (2R,3S,4R,5R)-6-methoxyimino-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate (PubChem CID 91753465) has the molecular formula C22H53NO7Si5 and a molecular weight of 584.10 g/mol. Its IUPAC name is trimethylsilyl (2R,3S,4R,5R)-6-methoxyimino-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate.
| Compound Name | trimethylsilyl (2R,3S,4R,5R)-6-methoxyimino-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate |
|---|---|
| PubChem CID | 91753465 |
| Molecular Formula | C22H53NO7Si5 |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | trimethylsilyl (2R,3S,4R,5R)-6-methoxyimino-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate |
| SMILES | CON=C[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H53NO7Si5/c1-25-23-17-18(26-31(2,3)4)19(27-32(5,6)7)20(28-33(8,9)10)21(29-34(11,12)13)22(24)30-35(14,15)16/h17-21H,1-16H3/t18-,19-,20+,21-/m1/s1 |
| InChIKey | FKLGHFYFJKVJFQ-MXEMCNAFSA-N |
| XLogP | 5.88 |
| TPSA | 84.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|