C20H48N2O6Si4 — CID 101280132
(Z,2S,3R,4S,5R)-N,N'-dimethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexane-1,6-diimine (PubChem CID 101280132) has the molecular formula C20H48N2O6Si4 and a molecular weight of 524.96 g/mol. Its IUPAC name is (Z,2S,3R,4S,5R)-N,N'-dimethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexane-1,6-diimine.
| Compound Name | (Z,2S,3R,4S,5R)-N,N'-dimethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexane-1,6-diimine |
|---|---|
| PubChem CID | 101280132 |
| Molecular Formula | C20H48N2O6Si4 |
| Molecular Weight | 524.96 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (Z,2S,3R,4S,5R)-N,N'-dimethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexane-1,6-diimine |
| SMILES | CO/N=C\[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](/C=N\OC)O[Si](C)(C)C |
| InChI | InChI=1S/C20H48N2O6Si4/c1-23-21-15-17(25-29(3,4)5)19(27-31(9,10)11)20(28-32(12,13)14)18(16-22-24-2)26-30(6,7)8/h15-20H,1-14H3/b21-15-,22-16-/t17-,18+,19+,20- |
| InChIKey | QLGCNHXGJIUDLW-ZBJMIGIXSA-N |
| XLogP | 5.13 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.96 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|