C18H37NO5 — CID 118336415
(2R,3R,4S,5E)-1,3,4-tributoxy-5-methoxyiminopentan-2-ol (PubChem CID 118336415) has the molecular formula C18H37NO5 and a molecular weight of 347.50 g/mol. Its IUPAC name is (2R,3R,4S,5E)-1,3,4-tributoxy-5-methoxyiminopentan-2-ol.
| Compound Name | (2R,3R,4S,5E)-1,3,4-tributoxy-5-methoxyiminopentan-2-ol |
|---|---|
| PubChem CID | 118336415 |
| Molecular Formula | C18H37NO5 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | (2R,3R,4S,5E)-1,3,4-tributoxy-5-methoxyiminopentan-2-ol |
| SMILES | CCCCOC[C@@H](O)[C@@H](OCCCC)[C@H](/C=N/OC)OCCCC |
| InChI | InChI=1S/C18H37NO5/c1-5-8-11-22-15-16(20)18(24-13-10-7-3)17(14-19-21-4)23-12-9-6-2/h14,16-18,20H,5-13,15H2,1-4H3/b19-14+/t16-,17+,18-/m1/s1 |
| InChIKey | GJLLCQAPZKZRGC-QUXAZTCASA-N |
| XLogP | 3.17 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|