C16H33NO7S — CID 118336424
[(2R,3R,4S,5E)-5-methoxyimino-1,3,4-tripropoxypentan-2-yl] methanesulfonate (PubChem CID 118336424) has the molecular formula C16H33NO7S and a molecular weight of 383.51 g/mol. Its IUPAC name is [(2R,3R,4S,5E)-5-methoxyimino-1,3,4-tripropoxypentan-2-yl] methanesulfonate.
| Compound Name | [(2R,3R,4S,5E)-5-methoxyimino-1,3,4-tripropoxypentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 118336424 |
| Molecular Formula | C16H33NO7S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | [(2R,3R,4S,5E)-5-methoxyimino-1,3,4-tripropoxypentan-2-yl] methanesulfonate |
| SMILES | CCCOC[C@@H](OS(C)(=O)=O)[C@H](OCCC)[C@H](/C=N/OC)OCCC |
| InChI | InChI=1S/C16H33NO7S/c1-6-9-21-13-15(24-25(5,18)19)16(23-11-8-3)14(12-17-20-4)22-10-7-2/h12,14-16H,6-11,13H2,1-5H3/b17-12+/t14-,15+,16+/m0/s1 |
| InChIKey | GVBWKXRGUPEJMJ-OBHLDDNWSA-N |
| XLogP | 1.98 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|