C11H8F9NO7 — CID 91694977
[(4E)-4-methoxyimino-2,3-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate (PubChem CID 91694977) has the molecular formula C11H8F9NO7 and a molecular weight of 437.17 g/mol. Its IUPAC name is [(4E)-4-methoxyimino-2,3-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate.
| Compound Name | [(4E)-4-methoxyimino-2,3-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91694977 |
| Molecular Formula | C11H8F9NO7 |
| Molecular Weight | 437.17 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | [(4E)-4-methoxyimino-2,3-bis[(2,2,2-trifluoroacetyl)oxy]butyl] 2,2,2-trifluoroacetate |
| SMILES | CO/N=C/C(OC(=O)C(F)(F)F)C(COC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H8F9NO7/c1-25-21-2-4(27-7(23)10(15,16)17)5(28-8(24)11(18,19)20)3-26-6(22)9(12,13)14/h2,4-5H,3H2,1H3/b21-2+ |
| InChIKey | LXLUTTKJBAJCOL-WKOHNKLBSA-N |
| XLogP | 1.67 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|