C15H37NO4Si3 — CID 553104
N-methoxy-3,4,5-tris(trimethylsilyloxy)pentan-1-imine (PubChem CID 553104) has the molecular formula C15H37NO4Si3 and a molecular weight of 379.72 g/mol. Its IUPAC name is N-methoxy-3,4,5-tris(trimethylsilyloxy)pentan-1-imine.
| Compound Name | N-methoxy-3,4,5-tris(trimethylsilyloxy)pentan-1-imine |
|---|---|
| PubChem CID | 553104 |
| Molecular Formula | C15H37NO4Si3 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-methoxy-3,4,5-tris(trimethylsilyloxy)pentan-1-imine |
| SMILES | CON=CCC(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H37NO4Si3/c1-17-16-12-11-14(19-22(5,6)7)15(20-23(8,9)10)13-18-21(2,3)4/h12,14-15H,11,13H2,1-10H3 |
| InChIKey | NHTUKGGVQKRAQX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|