C17H44O4Si4 — CID 552765
trimethyl-[1,2,5-tris(trimethylsilyloxy)pentan-3-yloxy]silane (PubChem CID 552765) has the molecular formula C17H44O4Si4 and a molecular weight of 424.88 g/mol. Its IUPAC name is trimethyl-[1,2,5-tris(trimethylsilyloxy)pentan-3-yloxy]silane.
| Compound Name | trimethyl-[1,2,5-tris(trimethylsilyloxy)pentan-3-yloxy]silane |
|---|---|
| PubChem CID | 552765 |
| Molecular Formula | C17H44O4Si4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | trimethyl-[1,2,5-tris(trimethylsilyloxy)pentan-3-yloxy]silane |
| SMILES | C[Si](C)(C)OCCC(O[Si](C)(C)C)C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H44O4Si4/c1-22(2,3)18-14-13-16(20-24(7,8)9)17(21-25(10,11)12)15-19-23(4,5)6/h16-17H,13-15H2,1-12H3 |
| InChIKey | HXWBUBLOJVCOEO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|