C17H43NO4Si4 — CID 91750499
N,3,4,5-tetrakis(trimethylsilyloxy)pentan-1-imine (PubChem CID 91750499) has the molecular formula C17H43NO4Si4 and a molecular weight of 437.88 g/mol. Its IUPAC name is N,3,4,5-tetrakis(trimethylsilyloxy)pentan-1-imine.
| Compound Name | N,3,4,5-tetrakis(trimethylsilyloxy)pentan-1-imine |
|---|---|
| PubChem CID | 91750499 |
| Molecular Formula | C17H43NO4Si4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | N,3,4,5-tetrakis(trimethylsilyloxy)pentan-1-imine |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(CC=NO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H43NO4Si4/c1-23(2,3)19-15-17(21-25(7,8)9)16(20-24(4,5)6)13-14-18-22-26(10,11)12/h14,16-17H,13,15H2,1-12H3 |
| InChIKey | FVEQTMJADYPZPG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|