C25H51NO5Si4 — CID 91709819
(Z)-N-phenylmethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexan-1-imine (PubChem CID 91709819) has the molecular formula C25H51NO5Si4 and a molecular weight of 558.03 g/mol. Its IUPAC name is (Z)-N-phenylmethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexan-1-imine.
| Compound Name | (Z)-N-phenylmethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexan-1-imine |
|---|---|
| PubChem CID | 91709819 |
| Molecular Formula | C25H51NO5Si4 |
| Molecular Weight | 558.03 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | (Z)-N-phenylmethoxy-2,3,4,5-tetrakis(trimethylsilyloxy)hexan-1-imine |
| SMILES | CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(/C=N\OCc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C25H51NO5Si4/c1-21(28-32(2,3)4)24(30-34(8,9)10)25(31-35(11,12)13)23(29-33(5,6)7)19-26-27-20-22-17-15-14-16-18-22/h14-19,21,23-25H,20H2,1-13H3/b26-19- |
| InChIKey | PTKGVKJVMQEDBT-XHPQRKPJSA-N |
| XLogP | 7.09 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.03 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|