C14H21F3O2Si — CID 175436607
trimethyl-(1,1,3-trifluoro-4-phenylmethoxybutan-2-yl)oxysilane (PubChem CID 175436607) has the molecular formula C14H21F3O2Si and a molecular weight of 306.40 g/mol. Its IUPAC name is trimethyl-(1,1,3-trifluoro-4-phenylmethoxybutan-2-yl)oxysilane.
| Compound Name | trimethyl-(1,1,3-trifluoro-4-phenylmethoxybutan-2-yl)oxysilane |
|---|---|
| PubChem CID | 175436607 |
| Molecular Formula | C14H21F3O2Si |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | trimethyl-(1,1,3-trifluoro-4-phenylmethoxybutan-2-yl)oxysilane |
| SMILES | C[Si](C)(C)OC(C(F)F)C(F)COCc1ccccc1 |
| InChI | InChI=1S/C14H21F3O2Si/c1-20(2,3)19-13(14(16)17)12(15)10-18-9-11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3 |
| InChIKey | AWFDMROGBQNMBE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|