C31H45F5N2O5Si — CID 10628009
(2,3,4,5,6-pentafluorophenyl)methyl (5Z,8R,9R,10E)-9-[(E)-methoxyiminomethyl]-8-[(Z)-N-methoxy-C-methylcarbonimidoyl]-12-trimethylsilyloxyhexadeca-5,10-dienoate (PubChem CID 10628009) has the molecular formula C31H45F5N2O5Si and a molecular weight of 648.79 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl (5Z,8R,9R,10E)-9-[(E)-methoxyiminomethyl]-8-[(Z)-N-methoxy-C-methylcarbonimidoyl]-12-trimethylsilyloxyhexadeca-5,10-dienoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl (5Z,8R,9R,10E)-9-[(E)-methoxyiminomethyl]-8-[(Z)-N-methoxy-C-methylcarbonimidoyl]-12-trimethylsilyloxyhexadeca-5,10-dienoate |
|---|---|
| PubChem CID | 10628009 |
| Molecular Formula | C31H45F5N2O5Si |
| Molecular Weight | 648.79 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl (5Z,8R,9R,10E)-9-[(E)-methoxyiminomethyl]-8-[(Z)-N-methoxy-C-methylcarbonimidoyl]-12-trimethylsilyloxyhexadeca-5,10-dienoate |
| SMILES | CCCCC(/C=C/[C@@H](/C=N/OC)[C@@H](C/C=C\CCCC(=O)OCc1c(F)c(F)c(F)c(F)c1F)/C(C)=N\OC)O[Si](C)(C)C |
| InChI | InChI=1S/C31H45F5N2O5Si/c1-8-9-14-23(43-44(5,6)7)18-17-22(19-37-40-3)24(21(2)38-41-4)15-12-10-11-13-16-26(39)42-20-25-27(32)29(34)31(36)30(35)28(25)33/h10,12,17-19,22-24H,8-9,11,13-16,20H2,1-7H3/b12-10-,18-17+,37-19+,38-21-/t22-,23?,24-/m0/s1 |
| InChIKey | PNVHSISKEBJRSG-LHALXLRHSA-N |
| XLogP | 8.40 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.79 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|