C25H44O8Si4 — CID 91735402
bis(trimethylsilyl) 2-trimethylsilyloxy-3-[(Z)-3-(4-trimethylsilyloxyphenyl)prop-2-enoyl]oxybutanedioate (PubChem CID 91735402) has the molecular formula C25H44O8Si4 and a molecular weight of 584.96 g/mol. Its IUPAC name is bis(trimethylsilyl) 2-trimethylsilyloxy-3-[(Z)-3-(4-trimethylsilyloxyphenyl)prop-2-enoyl]oxybutanedioate.
| Compound Name | bis(trimethylsilyl) 2-trimethylsilyloxy-3-[(Z)-3-(4-trimethylsilyloxyphenyl)prop-2-enoyl]oxybutanedioate |
|---|---|
| PubChem CID | 91735402 |
| Molecular Formula | C25H44O8Si4 |
| Molecular Weight | 584.96 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | bis(trimethylsilyl) 2-trimethylsilyloxy-3-[(Z)-3-(4-trimethylsilyloxyphenyl)prop-2-enoyl]oxybutanedioate |
| SMILES | C[Si](C)(C)OC(=O)C(OC(=O)/C=C\c1ccc(O[Si](C)(C)C)cc1)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C25H44O8Si4/c1-34(2,3)30-20-16-13-19(14-17-20)15-18-21(26)29-22(24(27)32-36(7,8)9)23(31-35(4,5)6)25(28)33-37(10,11)12/h13-18,22-23H,1-12H3/b18-15- |
| InChIKey | UXTFDOZFZVLZAV-SDXDJHTJSA-N |
| XLogP | 5.80 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.96 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|