C15H14O9 — CID 162919789
(2S,3S)-2-acetyloxy-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxybutanedioic acid (PubChem CID 162919789) has the molecular formula C15H14O9 and a molecular weight of 338.27 g/mol. Its IUPAC name is (2S,3S)-2-acetyloxy-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxybutanedioic acid.
| Compound Name | (2S,3S)-2-acetyloxy-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 162919789 |
| Molecular Formula | C15H14O9 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (2S,3S)-2-acetyloxy-3-[(Z)-3-(4-hydroxyphenyl)prop-2-enoyl]oxybutanedioic acid |
| SMILES | CC(=O)O[C@H](C(=O)O)[C@H](OC(=O)/C=C\c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C15H14O9/c1-8(16)23-12(14(19)20)13(15(21)22)24-11(18)7-4-9-2-5-10(17)6-3-9/h2-7,12-13,17H,1H3,(H,19,20)(H,21,22)/b7-4-/t12-,13-/m0/s1 |
| InChIKey | AILCSCQIQZTQJR-KNUBNCPHSA-N |
| XLogP | 0.42 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|