C16H16O10 — CID 38360108
(2S,3S)-3-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-methoxycarbonylpentanedioic acid (PubChem CID 38360108) has the molecular formula C16H16O10 and a molecular weight of 368.29 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-methoxycarbonylpentanedioic acid.
| Compound Name | (2S,3S)-3-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-methoxycarbonylpentanedioic acid |
|---|---|
| PubChem CID | 38360108 |
| Molecular Formula | C16H16O10 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-3-methoxycarbonylpentanedioic acid |
| SMILES | COC(=O)[C@](O)(CC(=O)O)[C@H](OC(=O)/C=C/c1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C16H16O10/c1-25-15(23)16(24,8-11(18)19)13(14(21)22)26-12(20)7-4-9-2-5-10(17)6-3-9/h2-7,13,17,24H,8H2,1H3,(H,18,19)(H,21,22)/b7-4+/t13-,16+/m1/s1 |
| InChIKey | WOCSYFBKPNKGJB-UCCUKHFHSA-N |
| XLogP | -0.22 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|