C23H22O9 — CID 123141716
(2R,3S)-2-[3-(4-hydroxyphenyl)prop-2-enoxy]-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]pentanedioic acid (PubChem CID 123141716) has the molecular formula C23H22O9 and a molecular weight of 442.42 g/mol. Its IUPAC name is (2R,3S)-2-[3-(4-hydroxyphenyl)prop-2-enoxy]-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]pentanedioic acid.
| Compound Name | (2R,3S)-2-[3-(4-hydroxyphenyl)prop-2-enoxy]-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]pentanedioic acid |
|---|---|
| PubChem CID | 123141716 |
| Molecular Formula | C23H22O9 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (2R,3S)-2-[3-(4-hydroxyphenyl)prop-2-enoxy]-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]pentanedioic acid |
| SMILES | O=C(O)C[C@H](OC(=O)C=Cc1ccc(O)cc1)[C@@H](OCC=Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H22O9/c24-17-8-3-15(4-9-17)2-1-13-31-22(23(29)30)19(14-20(26)27)32-21(28)12-7-16-5-10-18(25)11-6-16/h1-12,19,22,24-25H,13-14H2,(H,26,27)(H,29,30)/t19-,22+/m0/s1 |
| InChIKey | PKIQCZAFTIWYBN-SIKLNZKXSA-N |
| XLogP | 2.68 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|