C25H40O5 — CID 163195616
[(7R)-1,16-dihydroxyhexadecan-7-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 163195616) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(7R)-1,16-dihydroxyhexadecan-7-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(7R)-1,16-dihydroxyhexadecan-7-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163195616 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(7R)-1,16-dihydroxyhexadecan-7-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C\c1ccc(O)cc1)O[C@@H](CCCCCCO)CCCCCCCCCO |
| InChI | InChI=1S/C25H40O5/c26-20-10-6-3-1-2-4-8-12-24(13-9-5-7-11-21-27)30-25(29)19-16-22-14-17-23(28)18-15-22/h14-19,24,26-28H,1-13,20-21H2/b19-16-/t24-/m1/s1 |
| InChIKey | YCRUHXDBZDORLV-PVFXMYQXSA-N |
| XLogP | 5.37 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|