C20H50O6Si5 — CID 91753644
trimethylsilyl (3R,4S)-2,3,4,5-tetrakis(trimethylsilyloxy)pentanoate (PubChem CID 91753644) has the molecular formula C20H50O6Si5 and a molecular weight of 527.04 g/mol. Its IUPAC name is trimethylsilyl (3R,4S)-2,3,4,5-tetrakis(trimethylsilyloxy)pentanoate.
| Compound Name | trimethylsilyl (3R,4S)-2,3,4,5-tetrakis(trimethylsilyloxy)pentanoate |
|---|---|
| PubChem CID | 91753644 |
| Molecular Formula | C20H50O6Si5 |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | trimethylsilyl (3R,4S)-2,3,4,5-tetrakis(trimethylsilyloxy)pentanoate |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C20H50O6Si5/c1-27(2,3)22-16-17(23-28(4,5)6)18(24-29(7,8)9)19(25-30(10,11)12)20(21)26-31(13,14)15/h17-19H,16H2,1-15H3/t17-,18+,19?/m0/s1 |
| InChIKey | HUHNYCQTXQUQCH-PAMZHZACSA-N |
| XLogP | 5.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|