C15H32O5Si3 — CID 11849993
bis(trimethylsilyl) (2S,3R)-2-ethenyl-3-trimethylsilyloxybutanedioate (PubChem CID 11849993) has the molecular formula C15H32O5Si3 and a molecular weight of 376.67 g/mol. Its IUPAC name is bis(trimethylsilyl) (2S,3R)-2-ethenyl-3-trimethylsilyloxybutanedioate.
| Compound Name | bis(trimethylsilyl) (2S,3R)-2-ethenyl-3-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 11849993 |
| Molecular Formula | C15H32O5Si3 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | bis(trimethylsilyl) (2S,3R)-2-ethenyl-3-trimethylsilyloxybutanedioate |
| SMILES | C=C[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O5Si3/c1-11-12(14(16)19-22(5,6)7)13(18-21(2,3)4)15(17)20-23(8,9)10/h11-13H,1H2,2-10H3/t12-,13+/m0/s1 |
| InChIKey | UMDWNZXQURDZLE-QWHCGFSZSA-N |
| XLogP | 3.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|