C18H26O2 — CID 25018953
(4R,6R)-5,5-dimethyl-6-phenylmethoxynona-1,8-dien-4-ol (PubChem CID 25018953) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (4R,6R)-5,5-dimethyl-6-phenylmethoxynona-1,8-dien-4-ol.
| Compound Name | (4R,6R)-5,5-dimethyl-6-phenylmethoxynona-1,8-dien-4-ol |
|---|---|
| PubChem CID | 25018953 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (4R,6R)-5,5-dimethyl-6-phenylmethoxynona-1,8-dien-4-ol |
| SMILES | C=CC[C@@H](O)C(C)(C)[C@@H](CC=C)OCc1ccccc1 |
| InChI | InChI=1S/C18H26O2/c1-5-10-16(19)18(3,4)17(11-6-2)20-14-15-12-8-7-9-13-15/h5-9,12-13,16-17,19H,1-2,10-11,14H2,3-4H3/t16-,17-/m1/s1 |
| InChIKey | NXUYOWVFMBWGQW-IAGOWNOFSA-N |
| XLogP | 4.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|