C13H13F3O4 — CID 11289262
methyl 4-ethoxy-3,3-difluoro-4-(4-fluorophenyl)-2-oxobutanoate (PubChem CID 11289262) has the molecular formula C13H13F3O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is methyl 4-ethoxy-3,3-difluoro-4-(4-fluorophenyl)-2-oxobutanoate.
| Compound Name | methyl 4-ethoxy-3,3-difluoro-4-(4-fluorophenyl)-2-oxobutanoate |
|---|---|
| PubChem CID | 11289262 |
| Molecular Formula | C13H13F3O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | methyl 4-ethoxy-3,3-difluoro-4-(4-fluorophenyl)-2-oxobutanoate |
| SMILES | CCOC(c1ccc(F)cc1)C(F)(F)C(=O)C(=O)OC |
| InChI | InChI=1S/C13H13F3O4/c1-3-20-11(8-4-6-9(14)7-5-8)13(15,16)10(17)12(18)19-2/h4-7,11H,3H2,1-2H3 |
| InChIKey | DVMPRPWWMBXBAA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|