C15H19NO5 — CID 40521530
methyl (2R,3S)-2-acetamido-3-acetyloxy-2-methyl-3-phenylpropanoate (PubChem CID 40521530) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl (2R,3S)-2-acetamido-3-acetyloxy-2-methyl-3-phenylpropanoate.
| Compound Name | methyl (2R,3S)-2-acetamido-3-acetyloxy-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 40521530 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl (2R,3S)-2-acetamido-3-acetyloxy-2-methyl-3-phenylpropanoate |
| SMILES | COC(=O)[C@](C)(NC(C)=O)[C@@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO5/c1-10(17)16-15(3,14(19)20-4)13(21-11(2)18)12-8-6-5-7-9-12/h5-9,13H,1-4H3,(H,16,17)/t13-,15+/m0/s1 |
| InChIKey | ZZWQGUORGXGAQI-DZGCQCFKSA-N |
| XLogP | 1.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |