C34H34N2O8 — CID 174071307
2-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-4-yl]acetic acid (PubChem CID 174071307) has the molecular formula C34H34N2O8 and a molecular weight of 598.65 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-4-yl]acetic acid.
| Compound Name | 2-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-4-yl]acetic acid |
|---|---|
| PubChem CID | 174071307 |
| Molecular Formula | C34H34N2O8 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 2-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-4-yl]acetic acid |
| SMILES | COc1ccc(C(OC[C@@]2(C)O[C@@H](n3cc(C)c(=O)[nH]c3=O)C=C2CC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H34N2O8/c1-22-20-36(32(40)35-31(22)39)29-18-26(19-30(37)38)33(2,44-29)21-43-34(23-8-6-5-7-9-23,24-10-14-27(41-3)15-11-24)25-12-16-28(42-4)17-13-25/h5-18,20,29H,19,21H2,1-4H3,(H,37,38)(H,35,39,40)/t29-,33-/m1/s1 |
| InChIKey | GENWIRKLRUQODF-CYTLCNBWSA-N |
| XLogP | 4.56 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|