C35H38N2O8 — CID 25186317
1-[(1R,3R,4R,5S,6R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6,7-dihydroxy-5,6-dimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 25186317) has the molecular formula C35H38N2O8 and a molecular weight of 614.70 g/mol. Its IUPAC name is 1-[(1R,3R,4R,5S,6R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6,7-dihydroxy-5,6-dimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3R,4R,5S,6R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6,7-dihydroxy-5,6-dimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25186317 |
| Molecular Formula | C35H38N2O8 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 1-[(1R,3R,4R,5S,6R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6,7-dihydroxy-5,6-dimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@]23O[C@@H](n4cc(C)c(=O)[nH]c4=O)[C@H]([C@H](C)[C@@]2(C)O)[C@@H]3O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O8/c1-21-19-37(32(40)36-30(21)39)31-28-22(2)33(3,41)34(45-31,29(28)38)20-44-35(23-9-7-6-8-10-23,24-11-15-26(42-4)16-12-24)25-13-17-27(43-5)18-14-25/h6-19,22,28-29,31,38,41H,20H2,1-5H3,(H,36,39,40)/t22-,28+,29-,31+,33+,34+/m0/s1 |
| InChIKey | COBDHXJPKZTHJQ-RFWZVQLWSA-N |
| XLogP | 3.52 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|