C35H40N2O7Si — CID 10746556
1-[(4aR,6R,7aS)-4a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3H-furo[2,3-e]oxasilin-6-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10746556) has the molecular formula C35H40N2O7Si and a molecular weight of 628.80 g/mol. Its IUPAC name is 1-[(4aR,6R,7aS)-4a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3H-furo[2,3-e]oxasilin-6-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7aS)-4a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3H-furo[2,3-e]oxasilin-6-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10746556 |
| Molecular Formula | C35H40N2O7Si |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 1-[(4aR,6R,7aS)-4a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3H-furo[2,3-e]oxasilin-6-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@]23CC[Si](C)(C)O[C@H]2C[C@H](n2cc(C)c(=O)[nH]c2=O)O3)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H40N2O7Si/c1-24-22-37(33(39)36-32(24)38)31-21-30-34(43-31,19-20-45(4,5)44-30)23-42-35(25-9-7-6-8-10-25,26-11-15-28(40-2)16-12-26)27-13-17-29(41-3)18-14-27/h6-18,22,30-31H,19-21,23H2,1-5H3,(H,36,38,39)/t30-,31+,34+/m0/s1 |
| InChIKey | MNNWKDSXUFABJE-BEJSXWRTSA-N |
| XLogP | 5.52 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|