C41H42N2O8 — CID 25228724
1-[(2R,3aR,7aR)-7a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3a-phenylmethoxy-3,4,5,7-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 25228724) has the molecular formula C41H42N2O8 and a molecular weight of 690.79 g/mol. Its IUPAC name is 1-[(2R,3aR,7aR)-7a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3a-phenylmethoxy-3,4,5,7-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3aR,7aR)-7a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3a-phenylmethoxy-3,4,5,7-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25228724 |
| Molecular Formula | C41H42N2O8 |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | 1-[(2R,3aR,7aR)-7a-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3a-phenylmethoxy-3,4,5,7-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@]23COCC[C@@]2(OCc2ccccc2)C[C@H](n2cc(C)c(=O)[nH]c2=O)O3)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H42N2O8/c1-29-25-43(38(45)42-37(29)44)36-24-39(49-26-30-10-6-4-7-11-30)22-23-48-27-40(39,51-36)28-50-41(31-12-8-5-9-13-31,32-14-18-34(46-2)19-15-32)33-16-20-35(47-3)21-17-33/h4-21,25,36H,22-24,26-28H2,1-3H3,(H,42,44,45)/t36-,39-,40-/m1/s1 |
| InChIKey | UDCUZIDWPZSVML-UQLTYJDHSA-N |
| XLogP | 5.90 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|