C43H46N2O10S — CID 25228925
[(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-3-prop-2-enyloxolan-2-yl]methyl methanesulfonate (PubChem CID 25228925) has the molecular formula C43H46N2O10S and a molecular weight of 782.91 g/mol. Its IUPAC name is [(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-3-prop-2-enyloxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-3-prop-2-enyloxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 25228925 |
| Molecular Formula | C43H46N2O10S |
| Molecular Weight | 782.91 g/mol |
| Exact Mass | 782.29 |
| IUPAC Name | [(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-phenylmethoxy-3-prop-2-enyloxolan-2-yl]methyl methanesulfonate |
| SMILES | C=CC[C@@]1(OCc2ccccc2)C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@]1(COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)COS(C)(=O)=O |
| InChI | InChI=1S/C43H46N2O10S/c1-6-25-41(52-28-32-13-9-7-10-14-32)26-38(45-27-31(2)39(46)44-40(45)47)55-42(41,30-54-56(5,48)49)29-53-43(33-15-11-8-12-16-33,34-17-21-36(50-3)22-18-34)35-19-23-37(51-4)24-20-35/h6-24,27,38H,1,25-26,28-30H2,2-5H3,(H,44,46,47)/t38-,41-,42-/m1/s1 |
| InChIKey | FBKVVUUSDGSBJA-XIJDGDAWSA-N |
| XLogP | 6.04 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.91 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|