C41H55N3O7Si — CID 174218676
1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(2,4-dimethyl-3-propan-2-ylsilyloxypentan-3-yl)morpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 174218676) has the molecular formula C41H55N3O7Si and a molecular weight of 729.99 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(2,4-dimethyl-3-propan-2-ylsilyloxypentan-3-yl)morpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(2,4-dimethyl-3-propan-2-ylsilyloxypentan-3-yl)morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174218676 |
| Molecular Formula | C41H55N3O7Si |
| Molecular Weight | 729.99 g/mol |
| Exact Mass | 729.38 |
| IUPAC Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-6-(2,4-dimethyl-3-propan-2-ylsilyloxypentan-3-yl)morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@]2(C(O[SiH2]C(C)C)(C(C)C)C(C)C)CNC[C@H](n3cc(C)c(=O)[nH]c3=O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H55N3O7Si/c1-27(2)41(28(3)4,51-52-29(5)6)39(25-42-23-36(50-39)44-24-30(7)37(45)43-38(44)46)26-49-40(31-13-11-10-12-14-31,32-15-19-34(47-8)20-16-32)33-17-21-35(48-9)22-18-33/h10-22,24,27-29,36,42H,23,25-26,52H2,1-9H3,(H,43,45,46)/t36-,39+/m1/s1 |
| InChIKey | QSYKUMULJFBNEA-VWMWMKPNSA-N |
| XLogP | 5.71 |
| TPSA | 113.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.99 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|