C47H65N3O7Si — CID 155681113
1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 155681113) has the molecular formula C47H65N3O7Si and a molecular weight of 812.14 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155681113 |
| Molecular Formula | C47H65N3O7Si |
| Molecular Weight | 812.14 g/mol |
| Exact Mass | 811.46 |
| IUPAC Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@]2(CO[Si](C(C)C)(C(C)C)C(C)C)CN(C3CCCCC3)C[C@H](n3cc(C)c(=O)[nH]c3=O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H65N3O7Si/c1-33(2)58(34(3)4,35(5)6)56-32-46(30-49(40-18-14-11-15-19-40)29-43(57-46)50-28-36(7)44(51)48-45(50)52)31-55-47(37-16-12-10-13-17-37,38-20-24-41(53-8)25-21-38)39-22-26-42(54-9)27-23-39/h10,12-13,16-17,20-28,33-35,40,43H,11,14-15,18-19,29-32H2,1-9H3,(H,48,51,52)/t43-,46+/m1/s1 |
| InChIKey | JJPYXLYZDKVOGY-RKHFOVIHSA-N |
| XLogP | 8.97 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.14 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|