C37H43N3O7 — CID 156647136
1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-(hydroxymethyl)morpholin-2-yl]pyrimidine-2,4-dione (PubChem CID 156647136) has the molecular formula C37H43N3O7 and a molecular weight of 641.77 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-(hydroxymethyl)morpholin-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-(hydroxymethyl)morpholin-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156647136 |
| Molecular Formula | C37H43N3O7 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-cyclohexyl-6-(hydroxymethyl)morpholin-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@@]2(CO)CN(C3CCCCC3)C[C@H](n3ccc(=O)[nH]c3=O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H43N3O7/c1-44-31-17-13-28(14-18-31)37(27-9-5-3-6-10-27,29-15-19-32(45-2)20-16-29)46-26-36(25-41)24-39(30-11-7-4-8-12-30)23-34(47-36)40-22-21-33(42)38-35(40)43/h3,5-6,9-10,13-22,30,34,41H,4,7-8,11-12,23-26H2,1-2H3,(H,38,42,43)/t34-,36+/m1/s1 |
| InChIKey | OIWSTABWEZJXRN-VHFKIGOXSA-N |
| XLogP | 4.46 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|