C32H34N2O6 — CID 178060841
1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 178060841) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is 1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178060841 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 1-[5-[2-[bis(4-methoxyphenyl)-phenylmethoxy]propyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC(C)CC2CCC(n3ccc(=O)[nH]c3=O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O6/c1-22(21-28-17-18-30(39-28)34-20-19-29(35)33-31(34)36)40-32(23-7-5-4-6-8-23,24-9-13-26(37-2)14-10-24)25-11-15-27(38-3)16-12-25/h4-16,19-20,22,28,30H,17-18,21H2,1-3H3,(H,33,35,36) |
| InChIKey | MBEQPTHCEYWOPB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|