C37H45FN2O7Si — CID 59419888
1-[(2R,3R,4S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 59419888) has the molecular formula C37H45FN2O7Si and a molecular weight of 676.86 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59419888 |
| Molecular Formula | C37H45FN2O7Si |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | 1-[(2R,3R,4S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(O[C@H](C)C2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](F)[C@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H45FN2O7Si/c1-24(32-33(47-48(7,8)36(2,3)4)31(38)34(45-32)40-23-22-30(41)39-35(40)42)46-37(25-12-10-9-11-13-25,26-14-18-28(43-5)19-15-26)27-16-20-29(44-6)21-17-27/h9-24,31-34H,1-8H3,(H,39,41,42)/t24-,31-,32?,33-,34-/m1/s1 |
| InChIKey | YFFDECUHAGURTJ-OJSOJFJFSA-N |
| XLogP | 6.58 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|