C39H46FN5O6Si — CID 59419887
1-[(2R,3R,4R)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-4-(1,2,4-triazol-1-yl)pyrimidin-2-one (PubChem CID 59419887) has the molecular formula C39H46FN5O6Si and a molecular weight of 727.91 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-4-(1,2,4-triazol-1-yl)pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-4-(1,2,4-triazol-1-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 59419887 |
| Molecular Formula | C39H46FN5O6Si |
| Molecular Weight | 727.91 g/mol |
| Exact Mass | 727.32 |
| IUPAC Name | 1-[(2R,3R,4R)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-4-(1,2,4-triazol-1-yl)pyrimidin-2-one |
| SMILES | COc1ccc(C(O[C@H](C)C2O[C@@H](n3ccc(-n4cncn4)nc3=O)[C@H](F)[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H46FN5O6Si/c1-26(50-39(27-12-10-9-11-13-27,28-14-18-30(47-5)19-15-28)29-16-20-31(48-6)21-17-29)34-35(51-52(7,8)38(2,3)4)33(40)36(49-34)44-23-22-32(43-37(44)46)45-25-41-24-42-45/h9-26,33-36H,1-8H3/t26-,33-,34?,35+,36-/m1/s1 |
| InChIKey | KMDNQYINTPCYNN-JGKGPOGXSA-N |
| XLogP | 6.86 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.91 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|