C44H50FN3O7Si — CID 89043656
N-[1-[(2R,3R,4S)-5-[(1S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 89043656) has the molecular formula C44H50FN3O7Si and a molecular weight of 779.98 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S)-5-[(1S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3R,4S)-5-[(1S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 89043656 |
| Molecular Formula | C44H50FN3O7Si |
| Molecular Weight | 779.98 g/mol |
| Exact Mass | 779.34 |
| IUPAC Name | N-[1-[(2R,3R,4S)-5-[(1S)-1-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(C(O[C@@H](C)C2O[C@@H](n3ccc(NC(=O)c4ccccc4)nc3=O)[C@H](F)[C@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C44H50FN3O7Si/c1-29(54-44(31-17-13-10-14-18-31,32-19-23-34(51-5)24-20-32)33-21-25-35(52-6)26-22-33)38-39(55-56(7,8)43(2,3)4)37(45)41(53-38)48-28-27-36(47-42(48)50)46-40(49)30-15-11-9-12-16-30/h9-29,37-39,41H,1-8H3,(H,46,47,49,50)/t29-,37+,38?,39+,41+/m0/s1 |
| InChIKey | XCCHARGVEPDVJS-WELGYMAASA-N |
| XLogP | 8.54 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.98 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|