C36H42N2O7 — CID 174105297
1-[(2R,3S,5S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]pentyl]-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 174105297) has the molecular formula C36H42N2O7 and a molecular weight of 614.74 g/mol. Its IUPAC name is 1-[(2R,3S,5S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]pentyl]-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]pentyl]-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174105297 |
| Molecular Formula | C36H42N2O7 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | 1-[(2R,3S,5S)-5-[(1R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]pentyl]-3-methoxy-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCC[C@@H](OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](OC)C1C |
| InChI | InChI=1S/C36H42N2O7/c1-6-7-13-30(32-24(2)33(43-5)34(44-32)38-23-22-31(39)37-35(38)40)45-36(25-11-9-8-10-12-25,26-14-18-28(41-3)19-15-26)27-16-20-29(42-4)21-17-27/h8-12,14-24,30,32-34H,6-7,13H2,1-5H3,(H,37,39,40)/t24?,30-,32+,33+,34-/m1/s1 |
| InChIKey | DJHWFQUNCUTJTO-GRAVJSFFSA-N |
| XLogP | 5.67 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|