C49H71N3O7Si — CID 155681128
1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-octyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 155681128) has the molecular formula C49H71N3O7Si and a molecular weight of 842.21 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-octyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-octyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155681128 |
| Molecular Formula | C49H71N3O7Si |
| Molecular Weight | 842.21 g/mol |
| Exact Mass | 841.51 |
| IUPAC Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-octyl-6-[tri(propan-2-yl)silyloxymethyl]morpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCCCCCCCN1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)(CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C49H71N3O7Si/c1-11-12-13-14-15-19-30-51-32-45(52-31-39(8)46(53)50-47(52)54)59-48(33-51,35-58-60(36(2)3,37(4)5)38(6)7)34-57-49(40-20-17-16-18-21-40,41-22-26-43(55-9)27-23-41)42-24-28-44(56-10)29-25-42/h16-18,20-29,31,36-38,45H,11-15,19,30,32-35H2,1-10H3,(H,50,53,54)/t45-,48+/m1/s1 |
| InChIKey | ONIDVVJZWNWCHN-RISBXJSMSA-N |
| XLogP | 9.99 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.21 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|