C34H34F3N3O8 — CID 151747911
N-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 151747911) has the molecular formula C34H34F3N3O8 and a molecular weight of 669.65 g/mol. Its IUPAC name is N-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 151747911 |
| Molecular Formula | C34H34F3N3O8 |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | N-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(C(OC[C@@]2(NC(=O)C(F)(F)F)O[C@@](C)(n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H34F3N3O8/c1-21-19-40(30(44)38-28(21)42)31(2)18-27(41)32(48-31,39-29(43)34(35,36)37)20-47-33(22-8-6-5-7-9-22,23-10-14-25(45-3)15-11-23)24-12-16-26(46-4)17-13-24/h5-17,19,27,41H,18,20H2,1-4H3,(H,39,43)(H,38,42,44)/t27-,31+,32+/m0/s1 |
| InChIKey | RNXCOTIOYPSISE-QUBLIXHFSA-N |
| XLogP | 3.70 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|