C38H37N5O8 — CID 172812580
2-[(1R,3R,4R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-pyrazin-2-yl-2-oxa-5-azabicyclo[2.2.1]heptan-7-yl]acetic acid (PubChem CID 172812580) has the molecular formula C38H37N5O8 and a molecular weight of 691.74 g/mol. Its IUPAC name is 2-[(1R,3R,4R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-pyrazin-2-yl-2-oxa-5-azabicyclo[2.2.1]heptan-7-yl]acetic acid.
| Compound Name | 2-[(1R,3R,4R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-pyrazin-2-yl-2-oxa-5-azabicyclo[2.2.1]heptan-7-yl]acetic acid |
|---|---|
| PubChem CID | 172812580 |
| Molecular Formula | C38H37N5O8 |
| Molecular Weight | 691.74 g/mol |
| Exact Mass | 691.26 |
| IUPAC Name | 2-[(1R,3R,4R,7S)-1-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-5-pyrazin-2-yl-2-oxa-5-azabicyclo[2.2.1]heptan-7-yl]acetic acid |
| SMILES | COc1ccc(C(OC[C@@]23CN(c4cnccn4)[C@@H]([C@H](n4cc(C)c(=O)[nH]c4=O)O2)[C@@H]3CC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H37N5O8/c1-24-21-42(36(47)41-34(24)46)35-33-30(19-32(44)45)37(51-35,22-43(33)31-20-39-17-18-40-31)23-50-38(25-7-5-4-6-8-25,26-9-13-28(48-2)14-10-26)27-11-15-29(49-3)16-12-27/h4-18,20-21,30,33,35H,19,22-23H2,1-3H3,(H,44,45)(H,41,46,47)/t30-,33+,35+,37+/m0/s1 |
| InChIKey | SJPOREQDWYRCDQ-MOOZYJMCSA-N |
| XLogP | 3.91 |
| TPSA | 158.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|