C10H14N4O3 — CID 136805824
9-[4-hydroxy-2-(hydroxymethyl)butyl]-1H-purin-6-one (PubChem CID 136805824) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 9-[4-hydroxy-2-(hydroxymethyl)butyl]-1H-purin-6-one.
| Compound Name | 9-[4-hydroxy-2-(hydroxymethyl)butyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136805824 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 9-[4-hydroxy-2-(hydroxymethyl)butyl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2CC(CO)CCO |
| InChI | InChI=1S/C10H14N4O3/c15-2-1-7(4-16)3-14-6-13-8-9(14)11-5-12-10(8)17/h5-7,15-16H,1-4H2,(H,11,12,17) |
| InChIKey | PQWODGZZFOUBRF-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |