C10H12N7O5P — CID 137258661
[1-[(2S)-1-hydroxy-3-(6-oxo-1H-purin-9-yl)propan-2-yl]triazol-4-yl]phosphonic acid (PubChem CID 137258661) has the molecular formula C10H12N7O5P and a molecular weight of 341.22 g/mol. Its IUPAC name is [1-[(2S)-1-hydroxy-3-(6-oxo-1H-purin-9-yl)propan-2-yl]triazol-4-yl]phosphonic acid.
| Compound Name | [1-[(2S)-1-hydroxy-3-(6-oxo-1H-purin-9-yl)propan-2-yl]triazol-4-yl]phosphonic acid |
|---|---|
| PubChem CID | 137258661 |
| Molecular Formula | C10H12N7O5P |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [1-[(2S)-1-hydroxy-3-(6-oxo-1H-purin-9-yl)propan-2-yl]triazol-4-yl]phosphonic acid |
| SMILES | O=c1[nH]cnc2c1ncn2C[C@@H](CO)n1cc(P(=O)(O)O)nn1 |
| InChI | InChI=1S/C10H12N7O5P/c18-3-6(17-2-7(14-15-17)23(20,21)22)1-16-5-13-8-9(16)11-4-12-10(8)19/h2,4-6,18H,1,3H2,(H,11,12,19)(H2,20,21,22)/t6-/m0/s1 |
| InChIKey | AATVRVAGFRHWER-LURJTMIESA-N |
| XLogP | -2.25 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|